Jervine
| Jervine | |
|---|---|
 | |
| IUPAC name | (2'R,3S,3'R,3'aS,6'S,6aS,6bS,7'aR,11aS,11bR)- 2,3,3'a,4,4',5',6,6',6a,6b,7,7',7'a,8,11a,11b- Hexadecahydro-3-hydroxy-3',6',10,11b- tetramethyl-spiro[9H-benzo[a]fluorene- 9,2'(3'H)-furo[3,2-b]pyridin]-11(1H)-one |
| Other names | (3β,23β)-17,23-Epoxy-3-hydroxyveratraman-11-one |
| Identifiers | |
| CAS number | [469-59-0] |
| SMILES | O=C4C1=[C@](C)[C@@]5(O[C@@](C[C@H](C)CN6) ([H])[C@@]6([H])[C@H]5C)CC[C@]([H])1[C@]3([H])C C=C2C[C@@H](O)CC[C@@](C)2[C@]34[H] |
| Properties | |
| Molecular formula | C27H39NO3 |
| Molar mass | 425.60 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references | |
Jervine is a steroidal alkaloid, C27H39NO3, derived from the Veratrum plant genus. Similar to cyclopamine, which also occurs in the Veratrum genus, it is a teratogen implicated in birth defects when consumed by animals during a certain period of their gestation.
References
Source: adapted by the editor from Wikipedia, the free encyclopedia; from the article "Jervine". Image Credit.
