Asarone
| α-Asarone | |
|---|---|
| IUPAC name | 1,2,4-Trimethoxy-5-[(E)-prop-1-enyl]benzene |
| Other names | alpha-Azaron cis-Isoelemicin 2,4,5-Trimethoxyphenyl-2-propene |
| Identifiers | |
| CAS number | [2883-98-9] |
| PubChem | |
| SMILES | CC=CC1=CC(=C(C=C1OC)OC)OC |
| Properties | |
| Molecular formula | C12H16O3 |
| Molar mass | 208.254 g mol−1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references | |
Asarone, which includes alpha (trans) and beta (cis) types, is an ether found in certain plants such as acorus and mugwort. Asarone is a possible precursor in the synthesis of the psychedelic phenethylamine TMA-2. As a volatile fragrance oil, it is used in killing pests and bacteria. Diseases that can be treated using drugs mixed with this compound include diphtheria, typhoid and tuberculosis.
See also
- Elemicin
Source: adapted by the editor from Wikipedia, the free encyclopedia; from the article "Asarone". Image Credit.